C52H62N4O3 — CID 167579037
[1-(cyclopropylmethyl)cycloheptyl]methanamine;N-[[1-(cyclopropylmethyl)cycloheptyl]methyl]-4-(2-pyridin-2-ylethynyl)benzamide;4-(2-pyridin-2-ylethynyl)benzoic acid (PubChem CID 167579037) has the molecular formula C52H62N4O3 and a molecular weight of 791.09 g/mol. Its IUPAC name is [1-(cyclopropylmethyl)cycloheptyl]methanamine;N-[[1-(cyclopropylmethyl)cycloheptyl]methyl]-4-(2-pyridin-2-ylethynyl)benzamide;4-(2-pyridin-2-ylethynyl)benzoic acid.
| Compound Name | [1-(cyclopropylmethyl)cycloheptyl]methanamine;N-[[1-(cyclopropylmethyl)cycloheptyl]methyl]-4-(2-pyridin-2-ylethynyl)benzamide;4-(2-pyridin-2-ylethynyl)benzoic acid |
|---|---|
| PubChem CID | 167579037 |
| Molecular Formula | C52H62N4O3 |
| Molecular Weight | 791.09 g/mol |
| Exact Mass | 790.48 |
| IUPAC Name | [1-(cyclopropylmethyl)cycloheptyl]methanamine;N-[[1-(cyclopropylmethyl)cycloheptyl]methyl]-4-(2-pyridin-2-ylethynyl)benzamide;4-(2-pyridin-2-ylethynyl)benzoic acid |
| SMILES | NCC1(CC2CC2)CCCCCC1.O=C(NCC1(CC2CC2)CCCCCC1)c1ccc(C#Cc2ccccn2)cc1.O=C(O)c1ccc(C#Cc2ccccn2)cc1 |
| InChI | InChI=1S/C26H30N2O.C14H9NO2.C12H23N/c29-25(28-20-26(19-22-8-9-22)16-4-1-2-5-17-26)23-13-10-21(11-14-23)12-15-24-7-3-6-18-27-24;16-14(17)12-7-4-11(5-8-12)6-9-13-3-1-2-10-15-13;13-10-12(9-11-5-6-11)7-3-1-2-4-8-12/h3,6-7,10-11,13-14,18,22H,1-2,4-5,8-9,16-17,19-20H2,(H,28,29);1-5,7-8,10H,(H,16,17);11H,1-10,13H2 |
| InChIKey | GXSRVHXUUASINW-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.09 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|