C29H33F3N4O4 — CID 167579939
cyclohexanamine;(1,3-dioxoisoindol-2-yl) cyclohexanecarboxylate;3-phenyl-3-(trifluoromethyl)diazirine (PubChem CID 167579939) has the molecular formula C29H33F3N4O4 and a molecular weight of 558.60 g/mol. Its IUPAC name is cyclohexanamine;(1,3-dioxoisoindol-2-yl) cyclohexanecarboxylate;3-phenyl-3-(trifluoromethyl)diazirine.
| Compound Name | cyclohexanamine;(1,3-dioxoisoindol-2-yl) cyclohexanecarboxylate;3-phenyl-3-(trifluoromethyl)diazirine |
|---|---|
| PubChem CID | 167579939 |
| Molecular Formula | C29H33F3N4O4 |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | cyclohexanamine;(1,3-dioxoisoindol-2-yl) cyclohexanecarboxylate;3-phenyl-3-(trifluoromethyl)diazirine |
| SMILES | FC(F)(F)C1(c2ccccc2)N=N1.NC1CCCCC1.O=C(ON1C(=O)c2ccccc2C1=O)C1CCCCC1 |
| InChI | InChI=1S/C15H15NO4.C8H5F3N2.C6H13N/c17-13-11-8-4-5-9-12(11)14(18)16(13)20-15(19)10-6-2-1-3-7-10;9-8(10,11)7(12-13-7)6-4-2-1-3-5-6;7-6-4-2-1-3-5-6/h4-5,8-10H,1-3,6-7H2;1-5H;6H,1-5,7H2 |
| InChIKey | HAXIUZHKAZABBP-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|