C17H23Cl2N4O5P — CID 167581193
[(2R,3R,4R,5S)-2-(4,6-dichloropyrazolo[5,4-d]pyrimidin-1-yl)-5-(2-dimethylphosphorylethoxymethyl)-4-methyloxolan-3-yl] acetate (PubChem CID 167581193) has the molecular formula C17H23Cl2N4O5P and a molecular weight of 465.27 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2-(4,6-dichloropyrazolo[5,4-d]pyrimidin-1-yl)-5-(2-dimethylphosphorylethoxymethyl)-4-methyloxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S)-2-(4,6-dichloropyrazolo[5,4-d]pyrimidin-1-yl)-5-(2-dimethylphosphorylethoxymethyl)-4-methyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 167581193 |
| Molecular Formula | C17H23Cl2N4O5P |
| Molecular Weight | 465.27 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | [(2R,3R,4R,5S)-2-(4,6-dichloropyrazolo[5,4-d]pyrimidin-1-yl)-5-(2-dimethylphosphorylethoxymethyl)-4-methyloxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](C)[C@@H](COCCP(C)(C)=O)O[C@H]1n1ncc2c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C17H23Cl2N4O5P/c1-9-12(8-26-5-6-29(3,4)25)28-16(13(9)27-10(2)24)23-15-11(7-20-23)14(18)21-17(19)22-15/h7,9,12-13,16H,5-6,8H2,1-4H3/t9-,12-,13-,16-/m1/s1 |
| InChIKey | HHZMIAWGRQZWIQ-RVXWVPLUSA-N |
| XLogP | 3.24 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|