C15H23NO6 — CID 16758241
[(2S,3S,6R)-3-acetyloxy-6-[2-(propan-2-ylideneamino)oxyethyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 16758241) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is [(2S,3S,6R)-3-acetyloxy-6-[2-(propan-2-ylideneamino)oxyethyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2S,3S,6R)-3-acetyloxy-6-[2-(propan-2-ylideneamino)oxyethyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 16758241 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [(2S,3S,6R)-3-acetyloxy-6-[2-(propan-2-ylideneamino)oxyethyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](CCON=C(C)C)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H23NO6/c1-10(2)16-20-8-7-13-5-6-14(21-12(4)18)15(22-13)9-19-11(3)17/h5-6,13-15H,7-9H2,1-4H3/t13-,14-,15-/m0/s1 |
| InChIKey | NLSWTORGLXVICM-KKUMJFAQSA-N |
| XLogP | 1.61 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|