C27H39N3O6 — CID 73324399
[3-acetyloxy-6-[2-[4-(2,3-dimethyl-6,7,8,9-tetrahydropyrido[3,2-b]azepin-5-yl)butan-2-ylideneamino]oxyethyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 73324399) has the molecular formula C27H39N3O6 and a molecular weight of 501.62 g/mol. Its IUPAC name is [3-acetyloxy-6-[2-[4-(2,3-dimethyl-6,7,8,9-tetrahydropyrido[3,2-b]azepin-5-yl)butan-2-ylideneamino]oxyethyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-6-[2-[4-(2,3-dimethyl-6,7,8,9-tetrahydropyrido[3,2-b]azepin-5-yl)butan-2-ylideneamino]oxyethyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 73324399 |
| Molecular Formula | C27H39N3O6 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | [3-acetyloxy-6-[2-[4-(2,3-dimethyl-6,7,8,9-tetrahydropyrido[3,2-b]azepin-5-yl)butan-2-ylideneamino]oxyethyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(CCON=C(C)CCN2CCCCc3nc(C)c(C)cc32)C=CC1OC(C)=O |
| InChI | InChI=1S/C27H39N3O6/c1-18-16-25-24(28-20(18)3)8-6-7-13-30(25)14-11-19(2)29-34-15-12-23-9-10-26(35-22(5)32)27(36-23)17-33-21(4)31/h9-10,16,23,26-27H,6-8,11-15,17H2,1-5H3 |
| InChIKey | REPGTJHYAOBTFP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 99.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|