C29H30N2O5S2 — CID 167583789
5-methoxy-3-[[4-[2-(2-oxobutylsulfonyl)-5-propylthiophen-3-yl]phenyl]methyl]-2-phenylimidazole-4-carbaldehyde (PubChem CID 167583789) has the molecular formula C29H30N2O5S2 and a molecular weight of 550.70 g/mol. Its IUPAC name is 5-methoxy-3-[[4-[2-(2-oxobutylsulfonyl)-5-propylthiophen-3-yl]phenyl]methyl]-2-phenylimidazole-4-carbaldehyde.
| Compound Name | 5-methoxy-3-[[4-[2-(2-oxobutylsulfonyl)-5-propylthiophen-3-yl]phenyl]methyl]-2-phenylimidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 167583789 |
| Molecular Formula | C29H30N2O5S2 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 5-methoxy-3-[[4-[2-(2-oxobutylsulfonyl)-5-propylthiophen-3-yl]phenyl]methyl]-2-phenylimidazole-4-carbaldehyde |
| SMILES | CCCc1cc(-c2ccc(Cn3c(-c4ccccc4)nc(OC)c3C=O)cc2)c(S(=O)(=O)CC(=O)CC)s1 |
| InChI | InChI=1S/C29H30N2O5S2/c1-4-9-24-16-25(29(37-24)38(34,35)19-23(33)5-2)21-14-12-20(13-15-21)17-31-26(18-32)28(36-3)30-27(31)22-10-7-6-8-11-22/h6-8,10-16,18H,4-5,9,17,19H2,1-3H3 |
| InChIKey | HNEXKSLOGFXFQH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|