C31H35N3O6S2 — CID 18462765
butyl [3-[4-[(5-formyl-4-methoxy-2-phenylimidazol-1-yl)methyl]phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfamoylformate (PubChem CID 18462765) has the molecular formula C31H35N3O6S2 and a molecular weight of 609.77 g/mol. Its IUPAC name is butyl [3-[4-[(5-formyl-4-methoxy-2-phenylimidazol-1-yl)methyl]phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfamoylformate.
| Compound Name | butyl [3-[4-[(5-formyl-4-methoxy-2-phenylimidazol-1-yl)methyl]phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfamoylformate |
|---|---|
| PubChem CID | 18462765 |
| Molecular Formula | C31H35N3O6S2 |
| Molecular Weight | 609.77 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | butyl [3-[4-[(5-formyl-4-methoxy-2-phenylimidazol-1-yl)methyl]phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfamoylformate |
| SMILES | CCCCOC(=O)S(=O)(=O)Nc1sc(CC(C)C)cc1-c1ccc(Cn2c(-c3ccccc3)nc(OC)c2C=O)cc1 |
| InChI | InChI=1S/C31H35N3O6S2/c1-5-6-16-40-31(36)42(37,38)33-30-26(18-25(41-30)17-21(2)3)23-14-12-22(13-15-23)19-34-27(20-35)29(39-4)32-28(34)24-10-8-7-9-11-24/h7-15,18,20-21,33H,5-6,16-17,19H2,1-4H3 |
| InChIKey | SVMIDPHYKRLNTL-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.77 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|