C40H47NO6 — CID 16758390
[(2S,3S,6S)-3-(4-methylphenoxy)-6-(2-phenylethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl (4Z)-4-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]iminopentanoate (PubChem CID 16758390) has the molecular formula C40H47NO6 and a molecular weight of 637.82 g/mol. Its IUPAC name is [(2S,3S,6S)-3-(4-methylphenoxy)-6-(2-phenylethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl (4Z)-4-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]iminopentanoate.
| Compound Name | [(2S,3S,6S)-3-(4-methylphenoxy)-6-(2-phenylethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl (4Z)-4-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]iminopentanoate |
|---|---|
| PubChem CID | 16758390 |
| Molecular Formula | C40H47NO6 |
| Molecular Weight | 637.82 g/mol |
| Exact Mass | 637.34 |
| IUPAC Name | [(2S,3S,6S)-3-(4-methylphenoxy)-6-(2-phenylethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl (4Z)-4-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]iminopentanoate |
| SMILES | C/C(CCC(=O)OC[C@@H]1O[C@H](C#Cc2ccccc2)C=C[C@@H]1Oc1ccc(C)cc1)=N/OC[C@@H](C)[C@H](OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C40H47NO6/c1-29(2)40(44-27-34-14-10-7-11-15-34)31(4)26-45-41-32(5)18-25-39(42)43-28-38-37(46-35-20-16-30(3)17-21-35)24-23-36(47-38)22-19-33-12-8-6-9-13-33/h6-17,20-21,23-24,29,31,36-38,40H,18,25-28H2,1-5H3/b41-32-/t31-,36-,37+,38+,40-/m1/s1 |
| InChIKey | FWXQUHUHUSJCBT-DKEPJQAKSA-N |
| XLogP | 7.71 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.82 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|