C26H24Cl6O4 — CID 167588027
1,1-dichloro-3,3-dimethyl-2a,8b-dihydrocyclobuta[c]chromen-2-one;2,2-dimethylchromene;2,2,2-trichloroacetyl chloride (PubChem CID 167588027) has the molecular formula C26H24Cl6O4 and a molecular weight of 613.19 g/mol. Its IUPAC name is 1,1-dichloro-3,3-dimethyl-2a,8b-dihydrocyclobuta[c]chromen-2-one;2,2-dimethylchromene;2,2,2-trichloroacetyl chloride.
| Compound Name | 1,1-dichloro-3,3-dimethyl-2a,8b-dihydrocyclobuta[c]chromen-2-one;2,2-dimethylchromene;2,2,2-trichloroacetyl chloride |
|---|---|
| PubChem CID | 167588027 |
| Molecular Formula | C26H24Cl6O4 |
| Molecular Weight | 613.19 g/mol |
| Exact Mass | 609.98 |
| IUPAC Name | 1,1-dichloro-3,3-dimethyl-2a,8b-dihydrocyclobuta[c]chromen-2-one;2,2-dimethylchromene;2,2,2-trichloroacetyl chloride |
| SMILES | CC1(C)C=Cc2ccccc2O1.CC1(C)Oc2ccccc2C2C1C(=O)C2(Cl)Cl.O=C(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H12Cl2O2.C11H12O.C2Cl4O/c1-12(2)10-9(13(14,15)11(10)16)7-5-3-4-6-8(7)17-12;1-11(2)8-7-9-5-3-4-6-10(9)12-11;3-1(7)2(4,5)6/h3-6,9-10H,1-2H3;3-8H,1-2H3; |
| InChIKey | IAZILUBIJXRGGB-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.19 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|