C24H19Cl2NO3 — CID 167588582
N-[1-(2,4-dichlorophenyl)-4-oxopentan-2-yl]dibenzofuran-4-carboxamide (PubChem CID 167588582) has the molecular formula C24H19Cl2NO3 and a molecular weight of 440.33 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)-4-oxopentan-2-yl]dibenzofuran-4-carboxamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)-4-oxopentan-2-yl]dibenzofuran-4-carboxamide |
|---|---|
| PubChem CID | 167588582 |
| Molecular Formula | C24H19Cl2NO3 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)-4-oxopentan-2-yl]dibenzofuran-4-carboxamide |
| SMILES | CC(=O)CC(Cc1ccc(Cl)cc1Cl)NC(=O)c1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C24H19Cl2NO3/c1-14(28)11-17(12-15-9-10-16(25)13-21(15)26)27-24(29)20-7-4-6-19-18-5-2-3-8-22(18)30-23(19)20/h2-10,13,17H,11-12H2,1H3,(H,27,29) |
| InChIKey | KZLCBKHJWRFRFI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |