C25H23F3N2O5 — CID 167591268
(3R)-3-deuterio-3-[6-[4-(2-ethoxy-6-fluorophenyl)-4,4-difluoro-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167591268) has the molecular formula C25H23F3N2O5 and a molecular weight of 489.47 g/mol. Its IUPAC name is (3R)-3-deuterio-3-[6-[4-(2-ethoxy-6-fluorophenyl)-4,4-difluoro-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3R)-3-deuterio-3-[6-[4-(2-ethoxy-6-fluorophenyl)-4,4-difluoro-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167591268 |
| Molecular Formula | C25H23F3N2O5 |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (3R)-3-deuterio-3-[6-[4-(2-ethoxy-6-fluorophenyl)-4,4-difluoro-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H][C@@]1(N2Cc3cc(CCC(=O)C(F)(F)c4c(F)cccc4OCC)ccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C25H23F3N2O5/c1-2-35-19-5-3-4-17(26)22(19)25(27,28)20(31)10-7-14-6-8-16-15(12-14)13-30(24(16)34)18-9-11-21(32)29-23(18)33/h3-6,8,12,18H,2,7,9-11,13H2,1H3,(H,29,32,33)/t18-/m1/s1/i18D |
| InChIKey | ILSMMOYGJYLDLT-UDEWCTGKSA-N |
| XLogP | 3.28 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|