C29H29FN4O3 — CID 167593720
tert-butyl 4-[1-amino-2-(1H-benzimidazol-2-ylcarbamoyl)-4-(4-fluorophenyl)but-1-enyl]benzoate (PubChem CID 167593720) has the molecular formula C29H29FN4O3 and a molecular weight of 500.57 g/mol. Its IUPAC name is tert-butyl 4-[1-amino-2-(1H-benzimidazol-2-ylcarbamoyl)-4-(4-fluorophenyl)but-1-enyl]benzoate.
| Compound Name | tert-butyl 4-[1-amino-2-(1H-benzimidazol-2-ylcarbamoyl)-4-(4-fluorophenyl)but-1-enyl]benzoate |
|---|---|
| PubChem CID | 167593720 |
| Molecular Formula | C29H29FN4O3 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | tert-butyl 4-[1-amino-2-(1H-benzimidazol-2-ylcarbamoyl)-4-(4-fluorophenyl)but-1-enyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(C(N)=C(CCc2ccc(F)cc2)C(=O)Nc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C29H29FN4O3/c1-29(2,3)37-27(36)20-13-11-19(12-14-20)25(31)22(17-10-18-8-15-21(30)16-9-18)26(35)34-28-32-23-6-4-5-7-24(23)33-28/h4-9,11-16H,10,17,31H2,1-3H3,(H2,32,33,34,35) |
| InChIKey | MYYXJYRGLYJOAJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|