C21H35ClN2O5 — CID 167595361
(2R)-2-amino-2-methylhexanoic acid;(2R)-2-benzamido-2-methylhexanoic acid;hydrochloride (PubChem CID 167595361) has the molecular formula C21H35ClN2O5 and a molecular weight of 430.97 g/mol. Its IUPAC name is (2R)-2-amino-2-methylhexanoic acid;(2R)-2-benzamido-2-methylhexanoic acid;hydrochloride.
| Compound Name | (2R)-2-amino-2-methylhexanoic acid;(2R)-2-benzamido-2-methylhexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 167595361 |
| Molecular Formula | C21H35ClN2O5 |
| Molecular Weight | 430.97 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (2R)-2-amino-2-methylhexanoic acid;(2R)-2-benzamido-2-methylhexanoic acid;hydrochloride |
| SMILES | CCCC[C@@](C)(N)C(=O)O.CCCC[C@@](C)(NC(=O)c1ccccc1)C(=O)O.Cl |
| InChI | InChI=1S/C14H19NO3.C7H15NO2.ClH/c1-3-4-10-14(2,13(17)18)15-12(16)11-8-6-5-7-9-11;1-3-4-5-7(2,8)6(9)10;/h5-9H,3-4,10H2,1-2H3,(H,15,16)(H,17,18);3-5,8H2,1-2H3,(H,9,10);1H/t14-;7-;/m11./s1 |
| InChIKey | AHOLKHHFHPWEMU-UVQCLHBPSA-N |
| XLogP | 3.85 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.97 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |