C34H33F2N5O6 — CID 167595780
(2R,3R,4S,5R)-2-(2-anilino-6-methylpurin-9-yl)-5-[[3-[2-[(1S)-2,2-difluoro-1,3-dihydroxy-3H-inden-1-yl]ethyl]phenoxy]methyl]oxolane-3,4-diol (PubChem CID 167595780) has the molecular formula C34H33F2N5O6 and a molecular weight of 645.66 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(2-anilino-6-methylpurin-9-yl)-5-[[3-[2-[(1S)-2,2-difluoro-1,3-dihydroxy-3H-inden-1-yl]ethyl]phenoxy]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(2-anilino-6-methylpurin-9-yl)-5-[[3-[2-[(1S)-2,2-difluoro-1,3-dihydroxy-3H-inden-1-yl]ethyl]phenoxy]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 167595780 |
| Molecular Formula | C34H33F2N5O6 |
| Molecular Weight | 645.66 g/mol |
| Exact Mass | 645.24 |
| IUPAC Name | (2R,3R,4S,5R)-2-(2-anilino-6-methylpurin-9-yl)-5-[[3-[2-[(1S)-2,2-difluoro-1,3-dihydroxy-3H-inden-1-yl]ethyl]phenoxy]methyl]oxolane-3,4-diol |
| SMILES | Cc1nc(Nc2ccccc2)nc2c1ncn2[C@@H]1O[C@H](COc2cccc(CC[C@]3(O)c4ccccc4C(O)C3(F)F)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C34H33F2N5O6/c1-19-26-30(40-32(38-19)39-21-9-3-2-4-10-21)41(18-37-26)31-28(43)27(42)25(47-31)17-46-22-11-7-8-20(16-22)14-15-33(45)24-13-6-5-12-23(24)29(44)34(33,35)36/h2-13,16,18,25,27-29,31,42-45H,14-15,17H2,1H3,(H,38,39,40)/t25-,27-,28-,29?,31-,33+/m1/s1 |
| InChIKey | MGPPMQVQMRHAPA-SLMPBUIOSA-N |
| XLogP | 4.08 |
| TPSA | 155.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |