C37H51ClN3O3P — CID 167596075
[3-[2-[5-[3,3-dimethyl-1-(5-tritiooxypentyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propoxy-methylphosphanyl] N-ethylmethanimidate chloride (PubChem CID 167596075) has the molecular formula C37H51ClN3O3P and a molecular weight of 654.27 g/mol. Its IUPAC name is [3-[2-[5-[3,3-dimethyl-1-(5-tritiooxypentyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propoxy-methylphosphanyl] N-ethylmethanimidate chloride.
| Compound Name | [3-[2-[5-[3,3-dimethyl-1-(5-tritiooxypentyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propoxy-methylphosphanyl] N-ethylmethanimidate chloride |
|---|---|
| PubChem CID | 167596075 |
| Molecular Formula | C37H51ClN3O3P |
| Molecular Weight | 654.27 g/mol |
| Exact Mass | 653.34 |
| IUPAC Name | [3-[2-[5-[3,3-dimethyl-1-(5-tritiooxypentyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propoxy-methylphosphanyl] N-ethylmethanimidate chloride |
| SMILES | [3H]OCCCCCN1C(=CC=CC=CC2=[N+](CCCOP(C)O/C=N/CC)c3ccccc3C2(C)C)C(C)(C)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C37H51N3O3P.ClH/c1-7-38-29-43-44(6)42-28-18-26-40-33-22-15-13-20-31(33)37(4,5)35(40)24-11-8-10-23-34-36(2,3)30-19-12-14-21-32(30)39(34)25-16-9-17-27-41;/h8,10-15,19-24,29,41H,7,9,16-18,25-28H2,1-6H3;1H/q+1;/p-1/b38-29+;/i41T; |
| InChIKey | PGQLDRDVTCDKNP-PWYDIQBUSA-M |
| XLogP | 5.44 |
| TPSA | 57.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.27 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|