C26H27F3N8O2S — CID 167596543
2,5-dimethyl-13-[2-methyl-4-(4-prop-2-enoylpiperazin-1-yl)anilino]-9-(2,2,2-trifluoroethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one (PubChem CID 167596543) has the molecular formula C26H27F3N8O2S and a molecular weight of 572.62 g/mol. Its IUPAC name is 2,5-dimethyl-13-[2-methyl-4-(4-prop-2-enoylpiperazin-1-yl)anilino]-9-(2,2,2-trifluoroethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one.
| Compound Name | 2,5-dimethyl-13-[2-methyl-4-(4-prop-2-enoylpiperazin-1-yl)anilino]-9-(2,2,2-trifluoroethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 167596543 |
| Molecular Formula | C26H27F3N8O2S |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | 2,5-dimethyl-13-[2-methyl-4-(4-prop-2-enoylpiperazin-1-yl)anilino]-9-(2,2,2-trifluoroethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
| SMILES | C=CC(=O)N1CCN(c2ccc(Nc3ncc4c(n3)N(C)c3sc(C)nc3C(=O)N4CC(F)(F)F)c(C)c2)CC1 |
| InChI | InChI=1S/C26H27F3N8O2S/c1-5-20(38)36-10-8-35(9-11-36)17-6-7-18(15(2)12-17)32-25-30-13-19-22(33-25)34(4)24-21(31-16(3)40-24)23(39)37(19)14-26(27,28)29/h5-7,12-13H,1,8-11,14H2,2-4H3,(H,30,32,33) |
| InChIKey | HAOZOKWXANZPIL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|