C20H34O5 — CID 167610195
carbon dioxide;(2,2-dimethyl-3-propylidenecyclobutyl)methanol;[3-(methoxymethylidene)-2,2-dimethylcyclobutyl]methanol (PubChem CID 167610195) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is carbon dioxide;(2,2-dimethyl-3-propylidenecyclobutyl)methanol;[3-(methoxymethylidene)-2,2-dimethylcyclobutyl]methanol.
| Compound Name | carbon dioxide;(2,2-dimethyl-3-propylidenecyclobutyl)methanol;[3-(methoxymethylidene)-2,2-dimethylcyclobutyl]methanol |
|---|---|
| PubChem CID | 167610195 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | carbon dioxide;(2,2-dimethyl-3-propylidenecyclobutyl)methanol;[3-(methoxymethylidene)-2,2-dimethylcyclobutyl]methanol |
| SMILES | CCC=C1CC(CO)C1(C)C.COC=C1CC(CO)C1(C)C.O=C=O |
| InChI | InChI=1S/C10H18O.C9H16O2.CO2/c1-4-5-8-6-9(7-11)10(8,2)3;1-9(2)7(5-10)4-8(9)6-11-3;2-1-3/h5,9,11H,4,6-7H2,1-3H3;6-7,10H,4-5H2,1-3H3; |
| InChIKey | KXXPFOMUQUWSQH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|