C12H22O2 — CID 59083995
(2Z)-2-(5-methoxy-2,2,3-trimethylcyclohexylidene)ethanol (PubChem CID 59083995) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (2Z)-2-(5-methoxy-2,2,3-trimethylcyclohexylidene)ethanol.
| Compound Name | (2Z)-2-(5-methoxy-2,2,3-trimethylcyclohexylidene)ethanol |
|---|---|
| PubChem CID | 59083995 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (2Z)-2-(5-methoxy-2,2,3-trimethylcyclohexylidene)ethanol |
| SMILES | COC1C/C(=C/CO)C(C)(C)C(C)C1 |
| InChI | InChI=1S/C12H22O2/c1-9-7-11(14-4)8-10(5-6-13)12(9,2)3/h5,9,11,13H,6-8H2,1-4H3/b10-5- |
| InChIKey | LYTNBHGQLBSENX-YHYXMXQVSA-N |
| XLogP | 2.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|