C11H17NO2 — CID 118460006
(NZ)-N-[(3aR,5R,6aS)-5-methoxyspiro[1,3a,4,5,6,6a-hexahydropentalene-3,1'-cyclopropane]-2-ylidene]hydroxylamine (PubChem CID 118460006) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (NZ)-N-[(3aR,5R,6aS)-5-methoxyspiro[1,3a,4,5,6,6a-hexahydropentalene-3,1'-cyclopropane]-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(3aR,5R,6aS)-5-methoxyspiro[1,3a,4,5,6,6a-hexahydropentalene-3,1'-cyclopropane]-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 118460006 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (NZ)-N-[(3aR,5R,6aS)-5-methoxyspiro[1,3a,4,5,6,6a-hexahydropentalene-3,1'-cyclopropane]-2-ylidene]hydroxylamine |
| SMILES | CO[C@@H]1C[C@@H]2C/C(=N/O)C3(CC3)[C@@H]2C1 |
| InChI | InChI=1S/C11H17NO2/c1-14-8-4-7-5-10(12-13)11(2-3-11)9(7)6-8/h7-9,13H,2-6H2,1H3/b12-10-/t7-,8-,9-/m1/s1 |
| InChIKey | NFRHXMGFRWAJIB-BQQHSKNKSA-N |
| XLogP | 2.04 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|