C12H21ClO — CID 72511475
2-(2-chloroethylidene)-4-methoxy-1,1,6-trimethylcyclohexane (PubChem CID 72511475) has the molecular formula C12H21ClO and a molecular weight of 216.75 g/mol. Its IUPAC name is 2-(2-chloroethylidene)-4-methoxy-1,1,6-trimethylcyclohexane.
| Compound Name | 2-(2-chloroethylidene)-4-methoxy-1,1,6-trimethylcyclohexane |
|---|---|
| PubChem CID | 72511475 |
| Molecular Formula | C12H21ClO |
| Molecular Weight | 216.75 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-(2-chloroethylidene)-4-methoxy-1,1,6-trimethylcyclohexane |
| SMILES | COC1CC(=CCCl)C(C)(C)C(C)C1 |
| InChI | InChI=1S/C12H21ClO/c1-9-7-11(14-4)8-10(5-6-13)12(9,2)3/h5,9,11H,6-8H2,1-4H3 |
| InChIKey | VJJMFRRJIDNKDI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.75 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|