C11H18O4 — CID 159663240
[3-(methoxymethylidene)-2,2-dimethylcyclobutyl]methyl methyl carbonate (PubChem CID 159663240) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is [3-(methoxymethylidene)-2,2-dimethylcyclobutyl]methyl methyl carbonate.
| Compound Name | [3-(methoxymethylidene)-2,2-dimethylcyclobutyl]methyl methyl carbonate |
|---|---|
| PubChem CID | 159663240 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | [3-(methoxymethylidene)-2,2-dimethylcyclobutyl]methyl methyl carbonate |
| SMILES | COC=C1CC(COC(=O)OC)C1(C)C |
| InChI | InChI=1S/C11H18O4/c1-11(2)8(6-13-3)5-9(11)7-15-10(12)14-4/h6,9H,5,7H2,1-4H3 |
| InChIKey | IGVGZKSRIOYBFV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|