C55H95N6O6PSi2 — CID 167614490
bis(tert-butyl N-[3-[hydroxy-[5-methyl-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-4-yl]methyl]cyclobutyl]carbamate);deuteriomethylphosphane (PubChem CID 167614490) has the molecular formula C55H95N6O6PSi2 and a molecular weight of 1024.55 g/mol. Its IUPAC name is bis(tert-butyl N-[3-[hydroxy-[5-methyl-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-4-yl]methyl]cyclobutyl]carbamate);deuteriomethylphosphane.
| Compound Name | bis(tert-butyl N-[3-[hydroxy-[5-methyl-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-4-yl]methyl]cyclobutyl]carbamate);deuteriomethylphosphane |
|---|---|
| PubChem CID | 167614490 |
| Molecular Formula | C55H95N6O6PSi2 |
| Molecular Weight | 1024.55 g/mol |
| Exact Mass | 1023.67 |
| IUPAC Name | bis(tert-butyl N-[3-[hydroxy-[5-methyl-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-4-yl]methyl]cyclobutyl]carbamate);deuteriomethylphosphane |
| SMILES | Cc1cnc2c(ccn2[Si](C(C)C)(C(C)C)C(C)C)c1C(O)C1CC(NC(=O)OC(C)(C)C)C1.Cc1cnc2c(ccn2[Si](C(C)C)(C(C)C)C(C)C)c1C(O)C1CC(NC(=O)OC(C)(C)C)C1.[2H]CP |
| InChI | InChI=1S/2C27H45N3O3Si.CH5P/c2*1-16(2)34(17(3)4,18(5)6)30-12-11-22-23(19(7)15-28-25(22)30)24(31)20-13-21(14-20)29-26(32)33-27(8,9)10;1-2/h2*11-12,15-18,20-21,24,31H,13-14H2,1-10H3,(H,29,32);2H2,1H3/i;;1D |
| InChIKey | LNVAUCXZNFHXKZ-PRQZKWGPSA-N |
| XLogP | 13.90 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1024.55 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|