C23H18F6N2O3 — CID 167614904
4-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2,4,5,7-tetrahydropyrrolo[2,3-b]pyridin-6-one (PubChem CID 167614904) has the molecular formula C23H18F6N2O3 and a molecular weight of 484.40 g/mol. Its IUPAC name is 4-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2,4,5,7-tetrahydropyrrolo[2,3-b]pyridin-6-one.
| Compound Name | 4-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2,4,5,7-tetrahydropyrrolo[2,3-b]pyridin-6-one |
|---|---|
| PubChem CID | 167614904 |
| Molecular Formula | C23H18F6N2O3 |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 4-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2,4,5,7-tetrahydropyrrolo[2,3-b]pyridin-6-one |
| SMILES | COc1cc(C2CC(=O)NC3=NCC=C32)ccc1OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H18F6N2O3/c1-33-19-8-13(17-10-20(32)31-21-16(17)4-5-30-21)2-3-18(19)34-11-12-6-14(22(24,25)26)9-15(7-12)23(27,28)29/h2-4,6-9,17H,5,10-11H2,1H3,(H,30,31,32) |
| InChIKey | LPHXKFVVZMLXPZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.40 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |