C18H24Br2N6O7 — CID 167615597
2-[(5-bromo-3-nitro-2-pyridinyl)oxy]acetaldehyde;2-[(5-bromo-3-nitro-2-pyridinyl)oxy]-N-ethylethanamine;ethanamine (PubChem CID 167615597) has the molecular formula C18H24Br2N6O7 and a molecular weight of 596.23 g/mol. Its IUPAC name is 2-[(5-bromo-3-nitro-2-pyridinyl)oxy]acetaldehyde;2-[(5-bromo-3-nitro-2-pyridinyl)oxy]-N-ethylethanamine;ethanamine.
| Compound Name | 2-[(5-bromo-3-nitro-2-pyridinyl)oxy]acetaldehyde;2-[(5-bromo-3-nitro-2-pyridinyl)oxy]-N-ethylethanamine;ethanamine |
|---|---|
| PubChem CID | 167615597 |
| Molecular Formula | C18H24Br2N6O7 |
| Molecular Weight | 596.23 g/mol |
| Exact Mass | 594.01 |
| IUPAC Name | 2-[(5-bromo-3-nitro-2-pyridinyl)oxy]acetaldehyde;2-[(5-bromo-3-nitro-2-pyridinyl)oxy]-N-ethylethanamine;ethanamine |
| SMILES | CCN.CCNCCOc1ncc(Br)cc1[N+](=O)[O-].O=CCOc1ncc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12BrN3O3.C7H5BrN2O4.C2H7N/c1-2-11-3-4-16-9-8(13(14)15)5-7(10)6-12-9;8-5-3-6(10(12)13)7(9-4-5)14-2-1-11;1-2-3/h5-6,11H,2-4H2,1H3;1,3-4H,2H2;2-3H2,1H3 |
| InChIKey | LROXCYMVKJQUOR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 185.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|