C10H12BrF3N2O — CID 106796823
2-[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]oxy]-N-ethylethanamine (PubChem CID 106796823) has the molecular formula C10H12BrF3N2O and a molecular weight of 313.12 g/mol. Its IUPAC name is 2-[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]oxy]-N-ethylethanamine.
| Compound Name | 2-[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]oxy]-N-ethylethanamine |
|---|---|
| PubChem CID | 106796823 |
| Molecular Formula | C10H12BrF3N2O |
| Molecular Weight | 313.12 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 2-[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]oxy]-N-ethylethanamine |
| SMILES | CCNCCOc1ncc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C10H12BrF3N2O/c1-2-15-3-4-17-9-8(10(12,13)14)5-7(11)6-16-9/h5-6,15H,2-4H2,1H3 |
| InChIKey | OJVJBOYGJNGHGB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.12 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|