C26H32N6O — CID 167616415
4-[4-[(3R)-3-tert-butylpiperidin-1-yl]anilino]-7-(3-methylimidazol-4-yl)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one (PubChem CID 167616415) has the molecular formula C26H32N6O and a molecular weight of 444.58 g/mol. Its IUPAC name is 4-[4-[(3R)-3-tert-butylpiperidin-1-yl]anilino]-7-(3-methylimidazol-4-yl)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one.
| Compound Name | 4-[4-[(3R)-3-tert-butylpiperidin-1-yl]anilino]-7-(3-methylimidazol-4-yl)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 167616415 |
| Molecular Formula | C26H32N6O |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 4-[4-[(3R)-3-tert-butylpiperidin-1-yl]anilino]-7-(3-methylimidazol-4-yl)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
| SMILES | Cn1cncc1-c1cnc(Nc2ccc(N3CCC[C@H](C(C)(C)C)C3)cc2)c2c1CNC2=O |
| InChI | InChI=1S/C26H32N6O/c1-26(2,3)17-6-5-11-32(15-17)19-9-7-18(8-10-19)30-24-23-21(13-29-25(23)33)20(12-28-24)22-14-27-16-31(22)4/h7-10,12,14,16-17H,5-6,11,13,15H2,1-4H3,(H,28,30)(H,29,33)/t17-/m0/s1 |
| InChIKey | BDUCJRXMXWWFFR-KRWDZBQOSA-N |
| XLogP | 4.73 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|