C13H12ClN3O2S — CID 167619741
ethyl 4-amino-4-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-sulfanylidenebut-3-enoate (PubChem CID 167619741) has the molecular formula C13H12ClN3O2S and a molecular weight of 309.78 g/mol. Its IUPAC name is ethyl 4-amino-4-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-sulfanylidenebut-3-enoate.
| Compound Name | ethyl 4-amino-4-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-sulfanylidenebut-3-enoate |
|---|---|
| PubChem CID | 167619741 |
| Molecular Formula | C13H12ClN3O2S |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | ethyl 4-amino-4-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-sulfanylidenebut-3-enoate |
| SMILES | CCOC(=O)C(=S)C=C(N)c1c[nH]c2nccc(Cl)c12 |
| InChI | InChI=1S/C13H12ClN3O2S/c1-2-19-13(18)10(20)5-9(15)7-6-17-12-11(7)8(14)3-4-16-12/h3-6H,2,15H2,1H3,(H,16,17) |
| InChIKey | PFCHDIGVIBFANE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|