C48H48B3N — CID 167629406
5,11,17-tritert-butyl-8,14,22-triphenyl-1-aza-8,14,22-triborahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 167629406) has the molecular formula C48H48B3N and a molecular weight of 671.36 g/mol. Its IUPAC name is 5,11,17-tritert-butyl-8,14,22-triphenyl-1-aza-8,14,22-triborahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 5,11,17-tritert-butyl-8,14,22-triphenyl-1-aza-8,14,22-triborahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 167629406 |
| Molecular Formula | C48H48B3N |
| Molecular Weight | 671.36 g/mol |
| Exact Mass | 671.41 |
| IUPAC Name | 5,11,17-tritert-butyl-8,14,22-triphenyl-1-aza-8,14,22-triborahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CC(C)(C)c1cc2c3c(c1)B(c1ccccc1)c1cc(C(C)(C)C)cc4c1N3c1c(cc(C(C)(C)C)cc1B4c1ccccc1)B2c1ccccc1 |
| InChI | InChI=1S/C48H48B3N/c1-46(2,3)31-25-37-43-38(26-31)50(35-21-15-11-16-22-35)40-28-33(48(7,8)9)30-42-45(40)52(43)44-39(49(37)34-19-13-10-14-20-34)27-32(47(4,5)6)29-41(44)51(42)36-23-17-12-18-24-36/h10-30H,1-9H3 |
| InChIKey | GOVPCGAXDQYUNO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.36 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|