C42H39B2N3 — CID 168794892
14-tert-butyl-11,17-bis(2,6-dimethylphenyl)-1,3,25-triaza-11,17-diboraheptacyclo[14.10.1.02,10.04,9.012,27.018,26.019,24]heptacosa-2(10),4,6,8,12,14,16(27),18(26),19,21,23-undecaene (PubChem CID 168794892) has the molecular formula C42H39B2N3 and a molecular weight of 607.42 g/mol. Its IUPAC name is 14-tert-butyl-11,17-bis(2,6-dimethylphenyl)-1,3,25-triaza-11,17-diboraheptacyclo[14.10.1.02,10.04,9.012,27.018,26.019,24]heptacosa-2(10),4,6,8,12,14,16(27),18(26),19,21,23-undecaene.
| Compound Name | 14-tert-butyl-11,17-bis(2,6-dimethylphenyl)-1,3,25-triaza-11,17-diboraheptacyclo[14.10.1.02,10.04,9.012,27.018,26.019,24]heptacosa-2(10),4,6,8,12,14,16(27),18(26),19,21,23-undecaene |
|---|---|
| PubChem CID | 168794892 |
| Molecular Formula | C42H39B2N3 |
| Molecular Weight | 607.42 g/mol |
| Exact Mass | 607.33 |
| IUPAC Name | 14-tert-butyl-11,17-bis(2,6-dimethylphenyl)-1,3,25-triaza-11,17-diboraheptacyclo[14.10.1.02,10.04,9.012,27.018,26.019,24]heptacosa-2(10),4,6,8,12,14,16(27),18(26),19,21,23-undecaene |
| SMILES | Cc1cccc(C)c1B1c2cc(C(C)(C)C)cc3c2N(c2[nH]c4ccccc4c21)c1[nH]c2ccccc2c1B3c1c(C)cccc1C |
| InChI | InChI=1S/C42H39B2N3/c1-24-14-12-15-25(2)35(24)43-31-22-28(42(5,6)7)23-32-39(31)47(40-37(43)29-18-8-10-20-33(29)45-40)41-38(30-19-9-11-21-34(30)46-41)44(32)36-26(3)16-13-17-27(36)4/h8-23,45-46H,1-7H3 |
| InChIKey | ADMHQGOAVJSLLO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 34.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.42 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|