C24H28N6O2S — CID 167630178
(2S)-2-[methyl(prop-2-enoyl)amino]-N-[3-[2-methyl-6-[(5-pyridin-4-yl-1,3-thiazol-2-yl)methyl]pyrimidin-4-yl]propyl]propanamide (PubChem CID 167630178) has the molecular formula C24H28N6O2S and a molecular weight of 464.60 g/mol. Its IUPAC name is (2S)-2-[methyl(prop-2-enoyl)amino]-N-[3-[2-methyl-6-[(5-pyridin-4-yl-1,3-thiazol-2-yl)methyl]pyrimidin-4-yl]propyl]propanamide.
| Compound Name | (2S)-2-[methyl(prop-2-enoyl)amino]-N-[3-[2-methyl-6-[(5-pyridin-4-yl-1,3-thiazol-2-yl)methyl]pyrimidin-4-yl]propyl]propanamide |
|---|---|
| PubChem CID | 167630178 |
| Molecular Formula | C24H28N6O2S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | (2S)-2-[methyl(prop-2-enoyl)amino]-N-[3-[2-methyl-6-[(5-pyridin-4-yl-1,3-thiazol-2-yl)methyl]pyrimidin-4-yl]propyl]propanamide |
| SMILES | C=CC(=O)N(C)[C@@H](C)C(=O)NCCCc1cc(Cc2ncc(-c3ccncc3)s2)nc(C)n1 |
| InChI | InChI=1S/C24H28N6O2S/c1-5-23(31)30(4)16(2)24(32)26-10-6-7-19-13-20(29-17(3)28-19)14-22-27-15-21(33-22)18-8-11-25-12-9-18/h5,8-9,11-13,15-16H,1,6-7,10,14H2,2-4H3,(H,26,32)/t16-/m0/s1 |
| InChIKey | AFPQSFGMILVUHZ-INIZCTEOSA-N |
| XLogP | 2.98 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|