C22H35Br2F2N3Si — CID 167631090
5-bromo-2-fluoroaniline;5-bromo-2-fluoro-N-methyl-N-trimethylsilylaniline;N,N-diethylethanamine (PubChem CID 167631090) has the molecular formula C22H35Br2F2N3Si and a molecular weight of 567.43 g/mol. Its IUPAC name is 5-bromo-2-fluoroaniline;5-bromo-2-fluoro-N-methyl-N-trimethylsilylaniline;N,N-diethylethanamine.
| Compound Name | 5-bromo-2-fluoroaniline;5-bromo-2-fluoro-N-methyl-N-trimethylsilylaniline;N,N-diethylethanamine |
|---|---|
| PubChem CID | 167631090 |
| Molecular Formula | C22H35Br2F2N3Si |
| Molecular Weight | 567.43 g/mol |
| Exact Mass | 565.09 |
| IUPAC Name | 5-bromo-2-fluoroaniline;5-bromo-2-fluoro-N-methyl-N-trimethylsilylaniline;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.CN(c1cc(Br)ccc1F)[Si](C)(C)C.Nc1cc(Br)ccc1F |
| InChI | InChI=1S/C10H15BrFNSi.C6H5BrFN.C6H15N/c1-13(14(2,3)4)10-7-8(11)5-6-9(10)12;7-4-1-2-5(8)6(9)3-4;1-4-7(5-2)6-3/h5-7H,1-4H3;1-3H,9H2;4-6H2,1-3H3 |
| InChIKey | NUPLZIMDCSYXDB-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.43 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|