C24H23ClFN3O4 — CID 167634414
3-[(3aR,6R,6aS)-4-[(3-chloro-5-fluoro-2-methylquinolin-7-yl)oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-6-methylpyrimidin-4-one (PubChem CID 167634414) has the molecular formula C24H23ClFN3O4 and a molecular weight of 471.92 g/mol. Its IUPAC name is 3-[(3aR,6R,6aS)-4-[(3-chloro-5-fluoro-2-methylquinolin-7-yl)oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-6-methylpyrimidin-4-one.
| Compound Name | 3-[(3aR,6R,6aS)-4-[(3-chloro-5-fluoro-2-methylquinolin-7-yl)oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-6-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 167634414 |
| Molecular Formula | C24H23ClFN3O4 |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 3-[(3aR,6R,6aS)-4-[(3-chloro-5-fluoro-2-methylquinolin-7-yl)oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-6-methylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n([C@@H]2C=C(COc3cc(F)c4cc(Cl)c(C)nc4c3)[C@H]3OC(C)(C)O[C@H]32)cn1 |
| InChI | InChI=1S/C24H23ClFN3O4/c1-12-5-21(30)29(11-27-12)20-6-14(22-23(20)33-24(3,4)32-22)10-31-15-7-18(26)16-9-17(25)13(2)28-19(16)8-15/h5-9,11,20,22-23H,10H2,1-4H3/t20-,22-,23+/m1/s1 |
| InChIKey | OGNVZHRETUEDSN-MZYLBHOOSA-N |
| XLogP | 4.28 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|