C29H38N4O4 — CID 167635125
(1R,5S,22R,25S)-16-acetyl-5,13-dimethyl-25-propanoyl-3,17,18,21-tetrazapentacyclo[19.2.2.111,15.01,22.018,26]hexacosa-11(26),12,14,16-tetraene-4,20-dione (PubChem CID 167635125) has the molecular formula C29H38N4O4 and a molecular weight of 506.65 g/mol. Its IUPAC name is (1R,5S,22R,25S)-16-acetyl-5,13-dimethyl-25-propanoyl-3,17,18,21-tetrazapentacyclo[19.2.2.111,15.01,22.018,26]hexacosa-11(26),12,14,16-tetraene-4,20-dione.
| Compound Name | (1R,5S,22R,25S)-16-acetyl-5,13-dimethyl-25-propanoyl-3,17,18,21-tetrazapentacyclo[19.2.2.111,15.01,22.018,26]hexacosa-11(26),12,14,16-tetraene-4,20-dione |
|---|---|
| PubChem CID | 167635125 |
| Molecular Formula | C29H38N4O4 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | (1R,5S,22R,25S)-16-acetyl-5,13-dimethyl-25-propanoyl-3,17,18,21-tetrazapentacyclo[19.2.2.111,15.01,22.018,26]hexacosa-11(26),12,14,16-tetraene-4,20-dione |
| SMILES | CCC(=O)[C@@H]1C[C@]23CNC(=O)[C@@H](C)CCCCCc4cc(C)cc5c(C(C)=O)nn(c45)CC(=O)N1[C@@H]2C3 |
| InChI | InChI=1S/C29H38N4O4/c1-5-23(35)22-13-29-14-24(29)33(22)25(36)15-32-27-20(10-8-6-7-9-18(3)28(37)30-16-29)11-17(2)12-21(27)26(31-32)19(4)34/h11-12,18,22,24H,5-10,13-16H2,1-4H3,(H,30,37)/t18-,22-,24+,29-/m0/s1 |
| InChIKey | DRGVJSYRHYFUTB-SVFMSCPCSA-N |
| XLogP | 3.75 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |