C36H54N4O4 — CID 167639117
6-(2-benzylbutanoylamino)-5-oxo-N-[5-(pentan-2-ylcarbamoylamino)hexyl]-7-phenylheptanamide (PubChem CID 167639117) has the molecular formula C36H54N4O4 and a molecular weight of 606.85 g/mol. Its IUPAC name is 6-(2-benzylbutanoylamino)-5-oxo-N-[5-(pentan-2-ylcarbamoylamino)hexyl]-7-phenylheptanamide.
| Compound Name | 6-(2-benzylbutanoylamino)-5-oxo-N-[5-(pentan-2-ylcarbamoylamino)hexyl]-7-phenylheptanamide |
|---|---|
| PubChem CID | 167639117 |
| Molecular Formula | C36H54N4O4 |
| Molecular Weight | 606.85 g/mol |
| Exact Mass | 606.41 |
| IUPAC Name | 6-(2-benzylbutanoylamino)-5-oxo-N-[5-(pentan-2-ylcarbamoylamino)hexyl]-7-phenylheptanamide |
| SMILES | CCCC(C)NC(=O)NC(C)CCCCNC(=O)CCCC(=O)C(Cc1ccccc1)NC(=O)C(CC)Cc1ccccc1 |
| InChI | InChI=1S/C36H54N4O4/c1-5-16-27(3)38-36(44)39-28(4)17-13-14-24-37-34(42)23-15-22-33(41)32(26-30-20-11-8-12-21-30)40-35(43)31(6-2)25-29-18-9-7-10-19-29/h7-12,18-21,27-28,31-32H,5-6,13-17,22-26H2,1-4H3,(H,37,42)(H,40,43)(H2,38,39,44) |
| InChIKey | MXRQVWXGCFSURW-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.85 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|