C8H10Cl3NO — CID 167640161
(3S,7aR)-1-methylidene-3-(trichloromethyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazole (PubChem CID 167640161) has the molecular formula C8H10Cl3NO and a molecular weight of 242.53 g/mol. Its IUPAC name is (3S,7aR)-1-methylidene-3-(trichloromethyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazole.
| Compound Name | (3S,7aR)-1-methylidene-3-(trichloromethyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazole |
|---|---|
| PubChem CID | 167640161 |
| Molecular Formula | C8H10Cl3NO |
| Molecular Weight | 242.53 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | (3S,7aR)-1-methylidene-3-(trichloromethyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazole |
| SMILES | C=C1O[C@@H](C(Cl)(Cl)Cl)N2CCC[C@H]12 |
| InChI | InChI=1S/C8H10Cl3NO/c1-5-6-3-2-4-12(6)7(13-5)8(9,10)11/h6-7H,1-4H2/t6-,7+/m1/s1 |
| InChIKey | YXVSTWRGZRWOHR-RQJHMYQMSA-N |
| XLogP | 2.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|