C28H45N2O12P — CID 167641237
tert-butyl 3-oxoazetidine-1-carboxylate;tert-butyl 3-(2-oxooxolan-3-ylidene)azetidine-1-carboxylate;3-diethoxyphosphoryloxolan-2-one (PubChem CID 167641237) has the molecular formula C28H45N2O12P and a molecular weight of 632.64 g/mol. Its IUPAC name is tert-butyl 3-oxoazetidine-1-carboxylate;tert-butyl 3-(2-oxooxolan-3-ylidene)azetidine-1-carboxylate;3-diethoxyphosphoryloxolan-2-one.
| Compound Name | tert-butyl 3-oxoazetidine-1-carboxylate;tert-butyl 3-(2-oxooxolan-3-ylidene)azetidine-1-carboxylate;3-diethoxyphosphoryloxolan-2-one |
|---|---|
| PubChem CID | 167641237 |
| Molecular Formula | C28H45N2O12P |
| Molecular Weight | 632.64 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | tert-butyl 3-oxoazetidine-1-carboxylate;tert-butyl 3-(2-oxooxolan-3-ylidene)azetidine-1-carboxylate;3-diethoxyphosphoryloxolan-2-one |
| SMILES | CC(C)(C)OC(=O)N1CC(=C2CCOC2=O)C1.CC(C)(C)OC(=O)N1CC(=O)C1.CCOP(=O)(OCC)C1CCOC1=O |
| InChI | InChI=1S/C12H17NO4.C8H13NO3.C8H15O5P/c1-12(2,3)17-11(15)13-6-8(7-13)9-4-5-16-10(9)14;1-8(2,3)12-7(11)9-4-6(10)5-9;1-3-12-14(10,13-4-2)7-5-6-11-8(7)9/h4-7H2,1-3H3;4-5H2,1-3H3;7H,3-6H2,1-2H3 |
| InChIKey | PEPFLHFJNNXUGH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 164.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.64 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|