C13H24NO6P — CID 46913929
tert-butyl 6-diethoxyphosphoryl-3,6-dihydrooxazine-2-carboxylate (PubChem CID 46913929) has the molecular formula C13H24NO6P and a molecular weight of 321.31 g/mol. Its IUPAC name is tert-butyl 6-diethoxyphosphoryl-3,6-dihydrooxazine-2-carboxylate.
| Compound Name | tert-butyl 6-diethoxyphosphoryl-3,6-dihydrooxazine-2-carboxylate |
|---|---|
| PubChem CID | 46913929 |
| Molecular Formula | C13H24NO6P |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | tert-butyl 6-diethoxyphosphoryl-3,6-dihydrooxazine-2-carboxylate |
| SMILES | CCOP(=O)(OCC)C1C=CCN(C(=O)OC(C)(C)C)O1 |
| InChI | InChI=1S/C13H24NO6P/c1-6-17-21(16,18-7-2)11-9-8-10-14(20-11)12(15)19-13(3,4)5/h8-9,11H,6-7,10H2,1-5H3 |
| InChIKey | IHDZMHNSXAUINB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|