C23H45NO3Sn — CID 16719916
tert-butyl (3S)-3-(tributylstannylmethoxy)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 16719916) has the molecular formula C23H45NO3Sn and a molecular weight of 502.33 g/mol. Its IUPAC name is tert-butyl (3S)-3-(tributylstannylmethoxy)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(tributylstannylmethoxy)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 16719916 |
| Molecular Formula | C23H45NO3Sn |
| Molecular Weight | 502.33 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | tert-butyl (3S)-3-(tributylstannylmethoxy)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)CO[C@H]1C=CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C11H18NO3.3C4H9.Sn/c1-11(2,3)15-10(13)12-7-5-6-9(8-12)14-4;3*1-3-4-2;/h5-6,9H,4,7-8H2,1-3H3;3*1,3-4H2,2H3;/t9-;;;;/m0..../s1 |
| InChIKey | WSWQDYVFBNDKDS-ZWACTXNCSA-N |
| XLogP | 6.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.33 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|