C38H62N2O14 — CID 167642543
N-[1,3-bis(6-methoxy-3-oxohexoxy)-2-[(6-methoxy-3-oxohexoxy)methyl]propan-2-yl]-3-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]propanamide (PubChem CID 167642543) has the molecular formula C38H62N2O14 and a molecular weight of 770.91 g/mol. Its IUPAC name is N-[1,3-bis(6-methoxy-3-oxohexoxy)-2-[(6-methoxy-3-oxohexoxy)methyl]propan-2-yl]-3-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]propanamide.
| Compound Name | N-[1,3-bis(6-methoxy-3-oxohexoxy)-2-[(6-methoxy-3-oxohexoxy)methyl]propan-2-yl]-3-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]propanamide |
|---|---|
| PubChem CID | 167642543 |
| Molecular Formula | C38H62N2O14 |
| Molecular Weight | 770.91 g/mol |
| Exact Mass | 770.42 |
| IUPAC Name | N-[1,3-bis(6-methoxy-3-oxohexoxy)-2-[(6-methoxy-3-oxohexoxy)methyl]propan-2-yl]-3-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]propanamide |
| SMILES | COCCCC(=O)CCOCC(COCCC(=O)CCCOC)(COCCC(=O)CCCOC)NC(=O)CCOCCCC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C38H62N2O14/c1-48-20-4-8-32(42)15-24-52-28-38(29-53-25-16-33(43)9-5-21-49-2,30-54-26-17-34(44)10-6-22-50-3)39-35(45)18-27-51-23-7-11-31(41)14-19-40-36(46)12-13-37(40)47/h12-13H,4-11,14-30H2,1-3H3,(H,39,45) |
| InChIKey | CYXSEILMNDQRLI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 199.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.91 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|