C19H31N3O5 — CID 158497597
3-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]-N'-(2-methylpentyl)propanehydrazide (PubChem CID 158497597) has the molecular formula C19H31N3O5 and a molecular weight of 381.47 g/mol. Its IUPAC name is 3-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]-N'-(2-methylpentyl)propanehydrazide.
| Compound Name | 3-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]-N'-(2-methylpentyl)propanehydrazide |
|---|---|
| PubChem CID | 158497597 |
| Molecular Formula | C19H31N3O5 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 3-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]-N'-(2-methylpentyl)propanehydrazide |
| SMILES | CCCC(C)CNNC(=O)CCOCCCC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H31N3O5/c1-3-5-15(2)14-20-21-17(24)10-13-27-12-4-6-16(23)9-11-22-18(25)7-8-19(22)26/h7-8,15,20H,3-6,9-14H2,1-2H3,(H,21,24) |
| InChIKey | AXCOCKNANMAOTH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|