C23H16F2N4O6 — CID 167650789
(4-nitrophenyl) 1-[4-(difluoromethoxy)-3-pyridin-2-ylphenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxylate (PubChem CID 167650789) has the molecular formula C23H16F2N4O6 and a molecular weight of 482.40 g/mol. Its IUPAC name is (4-nitrophenyl) 1-[4-(difluoromethoxy)-3-pyridin-2-ylphenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxylate.
| Compound Name | (4-nitrophenyl) 1-[4-(difluoromethoxy)-3-pyridin-2-ylphenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 167650789 |
| Molecular Formula | C23H16F2N4O6 |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | (4-nitrophenyl) 1-[4-(difluoromethoxy)-3-pyridin-2-ylphenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxylate |
| SMILES | CC1=NN(c2ccc(OC(F)F)c(-c3ccccn3)c2)C(=O)C1C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H16F2N4O6/c1-13-20(22(31)34-16-8-5-14(6-9-16)29(32)33)21(30)28(27-13)15-7-10-19(35-23(24)25)17(12-15)18-4-2-3-11-26-18/h2-12,20,23H,1H3 |
| InChIKey | BTIJSIWIUJZRMS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 124.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|