C13H13FO5 — CID 167657440
[2-(4-fluorophenoxy)-2-oxoethyl] 2-(methoxymethyl)prop-2-enoate (PubChem CID 167657440) has the molecular formula C13H13FO5 and a molecular weight of 268.24 g/mol. Its IUPAC name is [2-(4-fluorophenoxy)-2-oxoethyl] 2-(methoxymethyl)prop-2-enoate.
| Compound Name | [2-(4-fluorophenoxy)-2-oxoethyl] 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 167657440 |
| Molecular Formula | C13H13FO5 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | [2-(4-fluorophenoxy)-2-oxoethyl] 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(COC)C(=O)OCC(=O)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C13H13FO5/c1-9(7-17-2)13(16)18-8-12(15)19-11-5-3-10(14)4-6-11/h3-6H,1,7-8H2,2H3 |
| InChIKey | TXJCQGPBEVTSLY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|