C29H30ClN3O2 — CID 167665606
1-[5-[4-chloro-2-[4-[3-(dimethylamino)propoxy]phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]but-3-en-2-one (PubChem CID 167665606) has the molecular formula C29H30ClN3O2 and a molecular weight of 488.03 g/mol. Its IUPAC name is 1-[5-[4-chloro-2-[4-[3-(dimethylamino)propoxy]phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]but-3-en-2-one.
| Compound Name | 1-[5-[4-chloro-2-[4-[3-(dimethylamino)propoxy]phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 167665606 |
| Molecular Formula | C29H30ClN3O2 |
| Molecular Weight | 488.03 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 1-[5-[4-chloro-2-[4-[3-(dimethylamino)propoxy]phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(-c2c(-c3ccc(OCCCN(C)C)cc3)[nH]c3nccc(Cl)c23)ccc1C |
| InChI | InChI=1S/C29H30ClN3O2/c1-5-23(34)18-22-17-21(8-7-19(22)2)26-27-25(30)13-14-31-29(27)32-28(26)20-9-11-24(12-10-20)35-16-6-15-33(3)4/h5,7-14,17H,1,6,15-16,18H2,2-4H3,(H,31,32) |
| InChIKey | SPALSBRADRMDLI-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.03 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|