C15H8I3NO9S — CID 167676817
2-[2-nitro-3-(2,4,6-triiodophenoxy)carbonylphenoxy]-2-oxoethanesulfonic acid (PubChem CID 167676817) has the molecular formula C15H8I3NO9S and a molecular weight of 759.01 g/mol. Its IUPAC name is 2-[2-nitro-3-(2,4,6-triiodophenoxy)carbonylphenoxy]-2-oxoethanesulfonic acid.
| Compound Name | 2-[2-nitro-3-(2,4,6-triiodophenoxy)carbonylphenoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 167676817 |
| Molecular Formula | C15H8I3NO9S |
| Molecular Weight | 759.01 g/mol |
| Exact Mass | 758.71 |
| IUPAC Name | 2-[2-nitro-3-(2,4,6-triiodophenoxy)carbonylphenoxy]-2-oxoethanesulfonic acid |
| SMILES | O=C(CS(=O)(=O)O)Oc1cccc(C(=O)Oc2c(I)cc(I)cc2I)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H8I3NO9S/c16-7-4-9(17)14(10(18)5-7)28-15(21)8-2-1-3-11(13(8)19(22)23)27-12(20)6-29(24,25)26/h1-5H,6H2,(H,24,25,26) |
| InChIKey | MUTPLCYCGUTXBS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.01 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|