C17H19N3O — CID 167678065
3-azidoadamantan-1-ol;hepta-1,3,5-triyne (PubChem CID 167678065) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-azidoadamantan-1-ol;hepta-1,3,5-triyne.
| Compound Name | 3-azidoadamantan-1-ol;hepta-1,3,5-triyne |
|---|---|
| PubChem CID | 167678065 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 3-azidoadamantan-1-ol;hepta-1,3,5-triyne |
| SMILES | C#CC#CC#CC.[N-]=[N+]=NC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C10H15N3O.C7H4/c11-13-12-9-2-7-1-8(3-9)5-10(14,4-7)6-9;1-3-5-7-6-4-2/h7-8,14H,1-6H2;1H,2H3 |
| InChIKey | VCNVNTSMBFHMOA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|