C11H17N3 — CID 92530301
(5S,7R)-1-azido-3-methyladamantane (PubChem CID 92530301) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is (5S,7R)-1-azido-3-methyladamantane.
| Compound Name | (5S,7R)-1-azido-3-methyladamantane |
|---|---|
| PubChem CID | 92530301 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | (5S,7R)-1-azido-3-methyladamantane |
| SMILES | CC12C[C@H]3C[C@@H](C1)CC(N=[N+]=[N-])(C3)C2 |
| InChI | InChI=1S/C11H17N3/c1-10-3-8-2-9(4-10)6-11(5-8,7-10)13-14-12/h8-9H,2-7H2,1H3/t8-,9+,10?,11? |
| InChIKey | ZTZVVHOMAGTOJW-IXBNRNDTSA-N |
| XLogP | 3.66 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|