C11H15NO2 — CID 130758661
(5S,7R)-3-isocyanatoadamantan-1-ol (PubChem CID 130758661) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (5S,7R)-3-isocyanatoadamantan-1-ol.
| Compound Name | (5S,7R)-3-isocyanatoadamantan-1-ol |
|---|---|
| PubChem CID | 130758661 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (5S,7R)-3-isocyanatoadamantan-1-ol |
| SMILES | O=C=NC12C[C@@H]3C[C@@H](CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C11H15NO2/c13-7-12-10-2-8-1-9(3-10)5-11(14,4-8)6-10/h8-9,14H,1-6H2/t8-,9+,10?,11? |
| InChIKey | RVCKFHSHHZFLBK-IXBNRNDTSA-N |
| XLogP | 1.41 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|