C16H35NO7 — CID 167681274
2-[bis(4,4,4-trimethoxybutyl)amino]ethanol (PubChem CID 167681274) has the molecular formula C16H35NO7 and a molecular weight of 353.46 g/mol. Its IUPAC name is 2-[bis(4,4,4-trimethoxybutyl)amino]ethanol.
| Compound Name | 2-[bis(4,4,4-trimethoxybutyl)amino]ethanol |
|---|---|
| PubChem CID | 167681274 |
| Molecular Formula | C16H35NO7 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 2-[bis(4,4,4-trimethoxybutyl)amino]ethanol |
| SMILES | COC(CCCN(CCO)CCCC(OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C16H35NO7/c1-19-15(20-2,21-3)9-7-11-17(13-14-18)12-8-10-16(22-4,23-5)24-6/h18H,7-14H2,1-6H3 |
| InChIKey | ZSRHIOPGHJIWBV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|