About carbon dioxide;methane;N-(3-methyl-2-oxobutyl)-2-propan-2-ylsulfanylpropanamide
carbon dioxide;methane;N-(3-methyl-2-oxobutyl)-2-propan-2-ylsulfanylpropanamide (PubChem CID 167682106) has the molecular formula C13H25NO4S
and a molecular weight of 291.41 g/mol. Its IUPAC name is carbon dioxide;methane;N-(3-methyl-2-oxobutyl)-2-propan-2-ylsulfanylpropanamide.
Molecular Properties
| Compound Name | carbon dioxide;methane;N-(3-methyl-2-oxobutyl)-2-propan-2-ylsulfanylpropanamide |
| PubChem CID | 167682106 |
| Molecular Formula | C13H25NO4S |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | carbon dioxide;methane;N-(3-methyl-2-oxobutyl)-2-propan-2-ylsulfanylpropanamide |
| SMILES | C.CC(C)SC(C)C(=O)NCC(=O)C(C)C.O=C=O |
| InChI | InChI=1S/C11H21NO2S.CO2.CH4/c1-7(2)10(13)6-12-11(14)9(5)15-8(3)4;2-1-3;/h7-9H,6H2,1-5H3,(H,12,14);;1H4 |
| InChIKey | VRPJYWIQRBRWFC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze carbon dioxide;methane;N-(3-methyl-2-oxobutyl)-2-propan-2-ylsulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;methane;N-(3-methyl-2-oxobutyl)-2-propan-2-ylsulfanylpropanamide?
The IUPAC name of carbon dioxide;methane;N-(3-methyl-2-oxobutyl)-2-propan-2-ylsulfanylpropanamide (CID 167682106) is carbon dioxide;methane;N-(3-methyl-2-oxobutyl)-2-propan-2-ylsulfanylpropanamide.
What is the SMILES notation for carbon dioxide;methane;N-(3-methyl-2-oxobutyl)-2-propan-2-ylsulfanylpropanamide?
The canonical SMILES for carbon dioxide;methane;N-(3-methyl-2-oxobutyl)-2-propan-2-ylsulfanylpropanamide is C.CC(C)SC(C)C(=O)NCC(=O)C(C)C.O=C=O.
What is the InChIKey of carbon dioxide;methane;N-(3-methyl-2-oxobutyl)-2-propan-2-ylsulfanylpropanamide?
The InChIKey is VRPJYWIQRBRWFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2S.CO2.CH4/c1-7(2)10(13)6-12-11(14)9(5)15-8(3)4;2-1-3;/h7-9H,6H2,1-5H3,(H,12,14);;1H4.
What are the key properties of carbon dioxide;methane;N-(3-methyl-2-oxobutyl)-2-propan-2-ylsulfanylpropanamide?
carbon dioxide;methane;N-(3-methyl-2-oxobutyl)-2-propan-2-ylsulfanylpropanamide has a molecular weight of 291.41 g/mol, XLogP of 1.91, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;methane;N-(3-methyl-2-oxobutyl)-2-propan-2-ylsulfanylpropanamide is sourced from PubChem (CID 167682106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).