C20H25N3O — CID 167684149
1-(4-methylpiperazin-1-yl)-4-phenyl-1-pyridin-3-ylbutan-2-one (PubChem CID 167684149) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-4-phenyl-1-pyridin-3-ylbutan-2-one.
| Compound Name | 1-(4-methylpiperazin-1-yl)-4-phenyl-1-pyridin-3-ylbutan-2-one |
|---|---|
| PubChem CID | 167684149 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-4-phenyl-1-pyridin-3-ylbutan-2-one |
| SMILES | CN1CCN(C(C(=O)CCc2ccccc2)c2cccnc2)CC1 |
| InChI | InChI=1S/C20H25N3O/c1-22-12-14-23(15-13-22)20(18-8-5-11-21-16-18)19(24)10-9-17-6-3-2-4-7-17/h2-8,11,16,20H,9-10,12-15H2,1H3 |
| InChIKey | DKKVHBUDXSAGBX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |